C25H45NSi — CID 59106104
cyclopentyl-[(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)methyl]-dimethylsilane (PubChem CID 59106104) has the molecular formula C25H45NSi and a molecular weight of 387.73 g/mol. Its IUPAC name is cyclopentyl-[(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)methyl]-dimethylsilane.
| Compound Name | cyclopentyl-[(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)methyl]-dimethylsilane |
|---|---|
| PubChem CID | 59106104 |
| Molecular Formula | C25H45NSi |
| Molecular Weight | 387.73 g/mol |
| Exact Mass | 387.33 |
| IUPAC Name | cyclopentyl-[(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)methyl]-dimethylsilane |
| SMILES | CC1CCC2C(C1)C1C(C[Si](C)(C)C3CCCC3)C3CCCCC3C1N2C |
| InChI | InChI=1S/C25H45NSi/c1-17-13-14-23-21(15-17)24-22(16-27(3,4)18-9-5-6-10-18)19-11-7-8-12-20(19)25(24)26(23)2/h17-25H,5-16H2,1-4H3 |
| InChIKey | BSGUDBSSNHZXRJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.73 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|