C19H34NSi — CID 166504670
CID 166504670 (PubChem CID 166504670) has the molecular formula C19H34NSi and a molecular weight of 304.57 g/mol.
| Compound Name | CID 166504670 |
|---|---|
| PubChem CID | 166504670 |
| Molecular Formula | C19H34NSi |
| Molecular Weight | 304.57 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | — |
| SMILES | CC1CCC2C(C1)C1C3CCCCC3[CH]C1N2[Si](C)(C)C |
| InChI | InChI=1S/C19H34NSi/c1-13-9-10-17-16(11-13)19-15-8-6-5-7-14(15)12-18(19)20(17)21(2,3)4/h12-19H,5-11H2,1-4H3 |
| InChIKey | JPYQOTCBPOCPNE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|