C28H51NSi — CID 59164897
(3-butylcyclopentyl)-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethylsilane (PubChem CID 59164897) has the molecular formula C28H51NSi and a molecular weight of 429.81 g/mol. Its IUPAC name is (3-butylcyclopentyl)-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethylsilane.
| Compound Name | (3-butylcyclopentyl)-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethylsilane |
|---|---|
| PubChem CID | 59164897 |
| Molecular Formula | C28H51NSi |
| Molecular Weight | 429.81 g/mol |
| Exact Mass | 429.38 |
| IUPAC Name | (3-butylcyclopentyl)-(5,8-dimethyl-2,3,4,4a,4b,5a,6,7,8,9,9a,9b,10,10a-tetradecahydro-1H-indeno[1,2-b]indol-10-yl)-dimethylsilane |
| SMILES | CCCCC1CCC([Si](C)(C)C2C3CCCCC3C3C2C2CC(C)CCC2N3C)C1 |
| InChI | InChI=1S/C28H51NSi/c1-6-7-10-20-14-15-21(18-20)30(4,5)28-23-12-9-8-11-22(23)27-26(28)24-17-19(2)13-16-25(24)29(27)3/h19-28H,6-18H2,1-5H3 |
| InChIKey | HJIOYYXKNZSYPA-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.81 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|