C18H31N — CID 147468172
2,5,6-trimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indole (PubChem CID 147468172) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2,5,6-trimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indole.
| Compound Name | 2,5,6-trimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indole |
|---|---|
| PubChem CID | 147468172 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2,5,6-trimethyl-2,3,4,4a,5a,6,6a,7,8,9,10,10a,10b,10c-tetradecahydro-1H-indeno[2,1-b]indole |
| SMILES | CC1CCC2C(C1)C1C3CCCCC3C(C)C1N2C |
| InChI | InChI=1S/C18H31N/c1-11-8-9-16-15(10-11)17-14-7-5-4-6-13(14)12(2)18(17)19(16)3/h11-18H,4-10H2,1-3H3 |
| InChIKey | BGHKYEZSZKEROZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |