C33H65NOSi — CID 171591079
N-[(4-cyclohexyl-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine (PubChem CID 171591079) has the molecular formula C33H65NOSi and a molecular weight of 519.98 g/mol. Its IUPAC name is N-[(4-cyclohexyl-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine.
| Compound Name | N-[(4-cyclohexyl-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 171591079 |
| Molecular Formula | C33H65NOSi |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.48 |
| IUPAC Name | N-[(4-cyclohexyl-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]-2-methylpropan-2-amine |
| SMILES | CC(C)C1CC2C(C3CCCCC3)CCCC2C1[Si](C)(CCCCCCOC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C33H65NOSi/c1-25(2)29-24-30-27(26-18-13-12-14-19-26)20-17-21-28(30)31(29)36(9,34-32(3,4)5)23-16-11-10-15-22-35-33(6,7)8/h25-31,34H,10-24H2,1-9H3 |
| InChIKey | PCRGOBNGAPXWEX-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|