C47H90Si — CID 164715478
[4-(3,5-ditert-butylcyclohexyl)-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dihexyl-(2,3,4,5-tetramethylcyclopentyl)silane (PubChem CID 164715478) has the molecular formula C47H90Si and a molecular weight of 683.32 g/mol. Its IUPAC name is [4-(3,5-ditert-butylcyclohexyl)-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dihexyl-(2,3,4,5-tetramethylcyclopentyl)silane.
| Compound Name | [4-(3,5-ditert-butylcyclohexyl)-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dihexyl-(2,3,4,5-tetramethylcyclopentyl)silane |
|---|---|
| PubChem CID | 164715478 |
| Molecular Formula | C47H90Si |
| Molecular Weight | 683.32 g/mol |
| Exact Mass | 682.68 |
| IUPAC Name | [4-(3,5-ditert-butylcyclohexyl)-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dihexyl-(2,3,4,5-tetramethylcyclopentyl)silane |
| SMILES | CCCCCC[Si](CCCCCC)(C1C(C)C(C)C(C)C1C)C1C(C(C)C)CC2C(C3CC(C(C)(C)C)CC(C(C)(C)C)C3)CCCC21 |
| InChI | InChI=1S/C47H90Si/c1-15-17-19-21-26-48(27-22-20-18-16-2,44-35(7)33(5)34(6)36(44)8)45-41-25-23-24-40(43(41)31-42(45)32(3)4)37-28-38(46(9,10)11)30-39(29-37)47(12,13)14/h32-45H,15-31H2,1-14H3 |
| InChIKey | FFFVUBRJGFKYPU-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.32 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|