C39H70SSi — CID 162471773
[4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-dimethylsilane (PubChem CID 162471773) has the molecular formula C39H70SSi and a molecular weight of 599.14 g/mol. Its IUPAC name is [4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-dimethylsilane.
| Compound Name | [4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-dimethylsilane |
|---|---|
| PubChem CID | 162471773 |
| Molecular Formula | C39H70SSi |
| Molecular Weight | 599.14 g/mol |
| Exact Mass | 598.50 |
| IUPAC Name | [4-(3,5-ditert-butylcyclohexyl)-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-dimethylsilane |
| SMILES | CC1CC2C(C3CC(C(C)(C)C)CC(C(C)(C)C)C3)CCCC2C1[Si](C)(C)C1C(C)C(C)C2C3CCCCC3SC21 |
| InChI | InChI=1S/C39H70SSi/c1-23-19-32-29(26-20-27(38(4,5)6)22-28(21-26)39(7,8)9)16-14-17-30(32)36(23)41(10,11)37-25(3)24(2)34-31-15-12-13-18-33(31)40-35(34)37/h23-37H,12-22H2,1-11H3 |
| InChIKey | XFCPBVGZYAZMRA-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.14 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|