C43H78Si — CID 164791074
cyclohexyl-[4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-methyl-(2,3,4,5-tetramethylcyclopentyl)silane (PubChem CID 164791074) has the molecular formula C43H78Si and a molecular weight of 623.18 g/mol. Its IUPAC name is cyclohexyl-[4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-methyl-(2,3,4,5-tetramethylcyclopentyl)silane.
| Compound Name | cyclohexyl-[4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-methyl-(2,3,4,5-tetramethylcyclopentyl)silane |
|---|---|
| PubChem CID | 164791074 |
| Molecular Formula | C43H78Si |
| Molecular Weight | 623.18 g/mol |
| Exact Mass | 622.59 |
| IUPAC Name | cyclohexyl-[4-(3,5-ditert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-methyl-(2,3,4,5-tetramethylcyclopentyl)silane |
| SMILES | CC1CC2C(CC3CCCC3C2C2CC(C(C)(C)C)CC(C(C)(C)C)C2)C1[Si](C)(C1CCCCC1)C1C(C)C(C)C(C)C1C |
| InChI | InChI=1S/C43H78Si/c1-26-21-37-38(40(26)44(12,35-18-14-13-15-19-35)41-29(4)27(2)28(3)30(41)5)24-31-17-16-20-36(31)39(37)32-22-33(42(6,7)8)25-34(23-32)43(9,10)11/h26-41H,13-25H2,1-12H3 |
| InChIKey | BZFIMVJGAXPTQX-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.18 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|