C40H70SSi — CID 164764026
[4-(4-tert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-diethylsilane (PubChem CID 164764026) has the molecular formula C40H70SSi and a molecular weight of 611.15 g/mol. Its IUPAC name is [4-(4-tert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-diethylsilane.
| Compound Name | [4-(4-tert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-diethylsilane |
|---|---|
| PubChem CID | 164764026 |
| Molecular Formula | C40H70SSi |
| Molecular Weight | 611.15 g/mol |
| Exact Mass | 610.50 |
| IUPAC Name | [4-(4-tert-butylcyclohexyl)-2-methyl-1,2,3,3a,4,4a,5,6,7,7a,8,8a-dodecahydro-s-indacen-1-yl]-(3,4-dimethyl-7-thiatricyclo[6.4.0.02,6]dodecan-5-yl)-diethylsilane |
| SMILES | CC[Si](CC)(C1C(C)CC2C1CC1CCCC1C2C1CCC(C(C)(C)C)CC1)C1C(C)C(C)C2C3CCCCC3SC21 |
| InChI | InChI=1S/C40H70SSi/c1-9-42(10-2,39-26(5)25(4)35-31-15-11-12-17-34(31)41-37(35)39)38-24(3)22-32-33(38)23-28-14-13-16-30(28)36(32)27-18-20-29(21-19-27)40(6,7)8/h24-39H,9-23H2,1-8H3 |
| InChIKey | MLNDBSVYRUDBTL-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.15 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|