About 8-hexyltricyclo[5.2.1.02,6]decane
8-hexyltricyclo[5.2.1.02,6]decane (PubChem CID 18442200) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is 8-hexyltricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 8-hexyltricyclo[5.2.1.02,6]decane |
| PubChem CID | 18442200 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 8-hexyltricyclo[5.2.1.02,6]decane |
| SMILES | CCCCCCC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C16H28/c1-2-3-4-5-7-12-10-13-11-16(12)15-9-6-8-14(13)15/h12-16H,2-11H2,1H3 |
| InChIKey | RKBXSGUQVBTCJY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-hexyltricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hexyltricyclo[5.2.1.02,6]decane?
The IUPAC name of 8-hexyltricyclo[5.2.1.02,6]decane (CID 18442200) is 8-hexyltricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 8-hexyltricyclo[5.2.1.02,6]decane?
The canonical SMILES for 8-hexyltricyclo[5.2.1.02,6]decane is CCCCCCC1CC2CC1C1CCCC21.
What is the InChIKey of 8-hexyltricyclo[5.2.1.02,6]decane?
The InChIKey is RKBXSGUQVBTCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28/c1-2-3-4-5-7-12-10-13-11-16(12)15-9-6-8-14(13)15/h12-16H,2-11H2,1H3.
What are the key properties of 8-hexyltricyclo[5.2.1.02,6]decane?
8-hexyltricyclo[5.2.1.02,6]decane has a molecular weight of 220.40 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hexyltricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 18442200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).