C26H53NOSSi — CID 164779465
2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,3,4,5-tetramethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine (PubChem CID 164779465) has the molecular formula C26H53NOSSi and a molecular weight of 455.87 g/mol. Its IUPAC name is 2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,3,4,5-tetramethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine.
| Compound Name | 2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,3,4,5-tetramethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine |
|---|---|
| PubChem CID | 164779465 |
| Molecular Formula | C26H53NOSSi |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.36 |
| IUPAC Name | 2-methyl-N-[methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-(2,3,4,5-tetramethyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]thiophen-6-yl)silyl]propan-2-amine |
| SMILES | CC1SC2C(C1C)C(C)C(C)C2[Si](C)(CCCCCCOC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C26H53NOSSi/c1-18-19(2)24(23-22(18)20(3)21(4)29-23)30(11,27-25(5,6)7)17-15-13-12-14-16-28-26(8,9)10/h18-24,27H,12-17H2,1-11H3 |
| InChIKey | AEBHJCSUZFWBNF-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|