C25H43NOSi — CID 140733141
N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]silyl]-2-methylpropan-2-amine (PubChem CID 140733141) has the molecular formula C25H43NOSi and a molecular weight of 401.71 g/mol. Its IUPAC name is N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]silyl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 140733141 |
| Molecular Formula | C25H43NOSi |
| Molecular Weight | 401.71 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-1H-inden-1-yl]silyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N[Si](C)(C)C1C=C(CCCCCCOC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C25H43NOSi/c1-24(2,3)26-28(7,8)23-19-20(21-16-12-13-17-22(21)23)15-11-9-10-14-18-27-25(4,5)6/h12-13,16-17,19,23,26H,9-11,14-15,18H2,1-8H3 |
| InChIKey | ASIPAODGSYQKMC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|