C23H49Cl2NOSiTi-2 — CID 177129995
tert-butyl-[methyl-[4-[(2-methylpropan-2-yl)oxy]butyl]-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium (PubChem CID 177129995) has the molecular formula C23H49Cl2NOSiTi-2 and a molecular weight of 502.51 g/mol. Its IUPAC name is tert-butyl-[methyl-[4-[(2-methylpropan-2-yl)oxy]butyl]-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium.
| Compound Name | tert-butyl-[methyl-[4-[(2-methylpropan-2-yl)oxy]butyl]-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 177129995 |
| Molecular Formula | C23H49Cl2NOSiTi-2 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | tert-butyl-[methyl-[4-[(2-methylpropan-2-yl)oxy]butyl]-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;carbanide;dichlorotitanium |
| SMILES | CC1C(C)C(C)C([Si](C)(CCCCOC(C)(C)C)[N-]C(C)(C)C)C1C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C22H46NOSi.CH3.2ClH.Ti/c1-16-17(2)19(4)20(18(16)3)25(11,23-21(5,6)7)15-13-12-14-24-22(8,9)10;;;;/h16-20H,12-15H2,1-11H3;1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | NBJBEMCBMOTIAC-UHFFFAOYSA-L |
| XLogP | 9.08 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|