C30H64N2Si2 — CID 59967062
N-[2-[(tert-butylamino)-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]ethyl-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]-2-methylpropan-2-amine (PubChem CID 59967062) has the molecular formula C30H64N2Si2 and a molecular weight of 509.03 g/mol. Its IUPAC name is N-[2-[(tert-butylamino)-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]ethyl-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-[(tert-butylamino)-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]ethyl-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59967062 |
| Molecular Formula | C30H64N2Si2 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.46 |
| IUPAC Name | N-[2-[(tert-butylamino)-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]ethyl-methyl-[(2R,3R,4S,5R)-2,3,4,5-tetramethylcyclopentyl]silyl]-2-methylpropan-2-amine |
| SMILES | C[C@@H]1[C@H](C)[C@@H](C)C([Si](C)(CC[Si](C)(NC(C)(C)C)C2[C@H](C)[C@H](C)[C@H](C)[C@H]2C)NC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C30H64N2Si2/c1-19-20(2)24(6)27(23(19)5)33(15,31-29(9,10)11)17-18-34(16,32-30(12,13)14)28-25(7)21(3)22(4)26(28)8/h19-28,31-32H,17-18H2,1-16H3/t19-,20+,21-,22+,23-,24-,25-,26-,27?,28?,33?,34?/m1/s1 |
| InChIKey | IDTFYYUTYWFJEL-PGVHAXEZSA-N |
| XLogP | 8.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|