C18H35NSi — CID 160555782
N-[butyl-(2,3,4,5,6,7-hexahydro-1H-inden-1-yl)-methylsilyl]-2-methylpropan-2-amine (PubChem CID 160555782) has the molecular formula C18H35NSi and a molecular weight of 293.57 g/mol. Its IUPAC name is N-[butyl-(2,3,4,5,6,7-hexahydro-1H-inden-1-yl)-methylsilyl]-2-methylpropan-2-amine.
| Compound Name | N-[butyl-(2,3,4,5,6,7-hexahydro-1H-inden-1-yl)-methylsilyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 160555782 |
| Molecular Formula | C18H35NSi |
| Molecular Weight | 293.57 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-[butyl-(2,3,4,5,6,7-hexahydro-1H-inden-1-yl)-methylsilyl]-2-methylpropan-2-amine |
| SMILES | CCCC[Si@](C)(NC(C)(C)C)C1CCC2=C1CCCC2 |
| InChI | InChI=1S/C18H35NSi/c1-6-7-14-20(5,19-18(2,3)4)17-13-12-15-10-8-9-11-16(15)17/h17,19H,6-14H2,1-5H3/t17?,20-/m0/s1 |
| InChIKey | UCUTYNKEXXCCDM-OZBJMMHXSA-N |
| XLogP | 5.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|