C17H33N — CID 15706651
2-methyl-6-undecyl-2,3,4,5-tetrahydropyridine (PubChem CID 15706651) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 2-methyl-6-undecyl-2,3,4,5-tetrahydropyridine.
| Compound Name | 2-methyl-6-undecyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 15706651 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 2-methyl-6-undecyl-2,3,4,5-tetrahydropyridine |
| SMILES | CCCCCCCCCCCC1=NC(C)CCC1 |
| InChI | InChI=1S/C17H33N/c1-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16(2)18-17/h16H,3-15H2,1-2H3 |
| InChIKey | AJBJEVCKGVWCJU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|