C19H35NO2 — CID 10781216
methyl 8-(6-pentyl-2,3,4,5-tetrahydropyridin-2-yl)octanoate (PubChem CID 10781216) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is methyl 8-(6-pentyl-2,3,4,5-tetrahydropyridin-2-yl)octanoate.
| Compound Name | methyl 8-(6-pentyl-2,3,4,5-tetrahydropyridin-2-yl)octanoate |
|---|---|
| PubChem CID | 10781216 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | methyl 8-(6-pentyl-2,3,4,5-tetrahydropyridin-2-yl)octanoate |
| SMILES | CCCCCC1=NC(CCCCCCCC(=O)OC)CCC1 |
| InChI | InChI=1S/C19H35NO2/c1-3-4-8-12-17-14-11-15-18(20-17)13-9-6-5-7-10-16-19(21)22-2/h18H,3-16H2,1-2H3 |
| InChIKey | KLHQPDHMTQGFKQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|