C40H78N2O2 — CID 70405269
2-heptadecyl-4-methyl-4,5-dihydro-1,3-oxazole;4-methyl-2-pentadecyl-4,5-dihydro-1,3-oxazole (PubChem CID 70405269) has the molecular formula C40H78N2O2 and a molecular weight of 619.08 g/mol. Its IUPAC name is 2-heptadecyl-4-methyl-4,5-dihydro-1,3-oxazole;4-methyl-2-pentadecyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-heptadecyl-4-methyl-4,5-dihydro-1,3-oxazole;4-methyl-2-pentadecyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 70405269 |
| Molecular Formula | C40H78N2O2 |
| Molecular Weight | 619.08 g/mol |
| Exact Mass | 618.61 |
| IUPAC Name | 2-heptadecyl-4-methyl-4,5-dihydro-1,3-oxazole;4-methyl-2-pentadecyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCCCCCCCCC1=NC(C)CO1.CCCCCCCCCCCCCCCCCC1=NC(C)CO1 |
| InChI | InChI=1S/C21H41NO.C19H37NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-22-20(2)19-23-21;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-20-18(2)17-21-19/h20H,3-19H2,1-2H3;18H,3-17H2,1-2H3 |
| InChIKey | NWPCKNVHIYAKRQ-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.08 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|