C12H23NO — CID 19844013
4-ethyl-2-heptyl-4,5-dihydro-1,3-oxazole (PubChem CID 19844013) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4-ethyl-2-heptyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-ethyl-2-heptyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 19844013 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4-ethyl-2-heptyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCC1=NC(CC)CO1 |
| InChI | InChI=1S/C12H23NO/c1-3-5-6-7-8-9-12-13-11(4-2)10-14-12/h11H,3-10H2,1-2H3 |
| InChIKey | YUAQWCHPMCXOBC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|