C19H35N — CID 162889339
2-hex-5-enyl-5-nonyl-3,4-dihydro-2H-pyrrole (PubChem CID 162889339) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 2-hex-5-enyl-5-nonyl-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-hex-5-enyl-5-nonyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 162889339 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 2-hex-5-enyl-5-nonyl-3,4-dihydro-2H-pyrrole |
| SMILES | C=CCCCCC1CCC(CCCCCCCCC)=N1 |
| InChI | InChI=1S/C19H35N/c1-3-5-7-9-10-11-13-15-19-17-16-18(20-19)14-12-8-6-4-2/h4,18H,2-3,5-17H2,1H3 |
| InChIKey | OATZINGONWAXGM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|