About 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane
1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane (PubChem CID 91501691) has the molecular formula C47H96
and a molecular weight of 661.29 g/mol. Its IUPAC name is 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane.
Molecular Properties
| Compound Name | 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane |
| PubChem CID | 91501691 |
| Molecular Formula | C47H96 |
| Molecular Weight | 661.29 g/mol |
| Exact Mass | 660.75 |
| IUPAC Name | 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane |
| SMILES | C=CCCCCCCCCCC.CCCCCCCCCCC1CC1CCCCCC.CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C19H38.C16H34.C12H24/c1-3-5-7-9-10-11-12-14-16-19-17-18(19)15-13-8-6-4-2;1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2;1-3-5-7-9-11-12-10-8-6-4-2/h18-19H,3-17H2,1-2H3;3-16H2,1-2H3;3H,1,4-12H2,2H3 |
| InChIKey | SUBFDHMQDSJHCF-UHFFFAOYSA-N |
| XLogP | 18.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 661.29 |
| LogP ≤ 5 | 18.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane?
The IUPAC name of 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane (CID 91501691) is 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane.
What is the SMILES notation for 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane?
The canonical SMILES for 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane is C=CCCCCCCCCCC.CCCCCCCCCCC1CC1CCCCCC.CCCCCCCCCCCCCCCC.
What is the InChIKey of 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane?
The InChIKey is SUBFDHMQDSJHCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38.C16H34.C12H24/c1-3-5-7-9-10-11-12-14-16-19-17-18(19)15-13-8-6-4-2;1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2;1-3-5-7-9-11-12-10-8-6-4-2/h18-19H,3-17H2,1-2H3;3-16H2,1-2H3;3H,1,4-12H2,2H3.
What are the key properties of 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane?
1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane has a molecular weight of 661.29 g/mol, XLogP of 18.31, 36 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-2-hexylcyclopropane;dodec-1-ene;hexadecane is sourced from PubChem (CID 91501691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).