About 1-ethenyl-2-octylcyclobutane;tetradec-1-ene
1-ethenyl-2-octylcyclobutane;tetradec-1-ene (PubChem CID 173458281) has the molecular formula C28H54
and a molecular weight of 390.74 g/mol. Its IUPAC name is 1-ethenyl-2-octylcyclobutane;tetradec-1-ene.
Molecular Properties
| Compound Name | 1-ethenyl-2-octylcyclobutane;tetradec-1-ene |
| PubChem CID | 173458281 |
| Molecular Formula | C28H54 |
| Molecular Weight | 390.74 g/mol |
| Exact Mass | 390.42 |
| IUPAC Name | 1-ethenyl-2-octylcyclobutane;tetradec-1-ene |
| SMILES | C=CC1CCC1CCCCCCCC.C=CCCCCCCCCCCCC |
| InChI | InChI=1S/C14H26.C14H28/c1-3-5-6-7-8-9-10-14-12-11-13(14)4-2;1-3-5-7-9-11-13-14-12-10-8-6-4-2/h4,13-14H,2-3,5-12H2,1H3;3H,1,4-14H2,2H3 |
| InChIKey | RQOCGBCTCYWCQA-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.74 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-octylcyclobutane;tetradec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-octylcyclobutane;tetradec-1-ene?
The IUPAC name of 1-ethenyl-2-octylcyclobutane;tetradec-1-ene (CID 173458281) is 1-ethenyl-2-octylcyclobutane;tetradec-1-ene.
What is the SMILES notation for 1-ethenyl-2-octylcyclobutane;tetradec-1-ene?
The canonical SMILES for 1-ethenyl-2-octylcyclobutane;tetradec-1-ene is C=CC1CCC1CCCCCCCC.C=CCCCCCCCCCCCC.
What is the InChIKey of 1-ethenyl-2-octylcyclobutane;tetradec-1-ene?
The InChIKey is RQOCGBCTCYWCQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26.C14H28/c1-3-5-6-7-8-9-10-14-12-11-13(14)4-2;1-3-5-7-9-11-13-14-12-10-8-6-4-2/h4,13-14H,2-3,5-12H2,1H3;3H,1,4-14H2,2H3.
What are the key properties of 1-ethenyl-2-octylcyclobutane;tetradec-1-ene?
1-ethenyl-2-octylcyclobutane;tetradec-1-ene has a molecular weight of 390.74 g/mol, XLogP of 10.43, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-octylcyclobutane;tetradec-1-ene is sourced from PubChem (CID 173458281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).