C19H32 — CID 153453271
13-tert-butyl-13-ethyltricyclo[7.3.1.02,7]tridec-2(7)-ene (PubChem CID 153453271) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is 13-tert-butyl-13-ethyltricyclo[7.3.1.02,7]tridec-2(7)-ene.
| Compound Name | 13-tert-butyl-13-ethyltricyclo[7.3.1.02,7]tridec-2(7)-ene |
|---|---|
| PubChem CID | 153453271 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 13-tert-butyl-13-ethyltricyclo[7.3.1.02,7]tridec-2(7)-ene |
| SMILES | CCC1(C(C)(C)C)C2CCCC1C1=C(CCCC1)C2 |
| InChI | InChI=1S/C19H32/c1-5-19(18(2,3)4)15-10-8-12-17(19)16-11-7-6-9-14(16)13-15/h15,17H,5-13H2,1-4H3 |
| InChIKey | VBLLPYZRCIORAX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|