C12H18O2 — CID 586685
8a-ethyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-1,8-dione (PubChem CID 586685) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 8a-ethyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-1,8-dione.
| Compound Name | 8a-ethyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-1,8-dione |
|---|---|
| PubChem CID | 586685 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 8a-ethyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-1,8-dione |
| SMILES | CCC12C(=O)CCCC1CCCC2=O |
| InChI | InChI=1S/C12H18O2/c1-2-12-9(5-3-7-10(12)13)6-4-8-11(12)14/h9H,2-8H2,1H3 |
| InChIKey | DAUXMCKGQDESSY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|