C13H20O2 — CID 102589366
(4aR,8aS)-8a-propyl-3,4,4a,5,7,8-hexahydro-2H-naphthalene-1,6-dione (PubChem CID 102589366) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (4aR,8aS)-8a-propyl-3,4,4a,5,7,8-hexahydro-2H-naphthalene-1,6-dione.
| Compound Name | (4aR,8aS)-8a-propyl-3,4,4a,5,7,8-hexahydro-2H-naphthalene-1,6-dione |
|---|---|
| PubChem CID | 102589366 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (4aR,8aS)-8a-propyl-3,4,4a,5,7,8-hexahydro-2H-naphthalene-1,6-dione |
| SMILES | CCC[C@]12CCC(=O)C[C@H]1CCCC2=O |
| InChI | InChI=1S/C13H20O2/c1-2-7-13-8-6-11(14)9-10(13)4-3-5-12(13)15/h10H,2-9H2,1H3/t10-,13+/m1/s1 |
| InChIKey | QDNNJZDVJZCEKR-MFKMUULPSA-N |
| XLogP | 2.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |