C11H18O2 — CID 141347991
2-ethyl-2-methylcyclooctane-1,5-dione (PubChem CID 141347991) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-ethyl-2-methylcyclooctane-1,5-dione.
| Compound Name | 2-ethyl-2-methylcyclooctane-1,5-dione |
|---|---|
| PubChem CID | 141347991 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-ethyl-2-methylcyclooctane-1,5-dione |
| SMILES | CCC1(C)CCC(=O)CCCC1=O |
| InChI | InChI=1S/C11H18O2/c1-3-11(2)8-7-9(12)5-4-6-10(11)13/h3-8H2,1-2H3 |
| InChIKey | VMJBCZANLPNIAN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |