C13H24O — CID 21241719
4,4,7,7-tetramethylcyclononan-1-one (PubChem CID 21241719) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is 4,4,7,7-tetramethylcyclononan-1-one.
| Compound Name | 4,4,7,7-tetramethylcyclononan-1-one |
|---|---|
| PubChem CID | 21241719 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 4,4,7,7-tetramethylcyclononan-1-one |
| SMILES | CC1(C)CCC(=O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H24O/c1-12(2)7-5-11(14)6-8-13(3,4)10-9-12/h5-10H2,1-4H3 |
| InChIKey | RPXHAPILQYPJFK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |