About methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane
methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane (PubChem CID 160725349) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane.
Molecular Properties
| Compound Name | methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane |
| PubChem CID | 160725349 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane |
| SMILES | C.CC1CCC(=O)CC1.CC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C9H18.C7H12O.CH4/c1-8-4-6-9(2,3)7-5-8;1-6-2-4-7(8)5-3-6;/h8H,4-7H2,1-3H3;6H,2-5H2,1H3;1H4 |
| InChIKey | RTQDZPYSQQVBEM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane?
The IUPAC name of methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane (CID 160725349) is methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane.
What is the SMILES notation for methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane?
The canonical SMILES for methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane is C.CC1CCC(=O)CC1.CC1CCC(C)(C)CC1.
What is the InChIKey of methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane?
The InChIKey is RTQDZPYSQQVBEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C7H12O.CH4/c1-8-4-6-9(2,3)7-5-8;1-6-2-4-7(8)5-3-6;/h8H,4-7H2,1-3H3;6H,2-5H2,1H3;1H4.
What are the key properties of methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane?
methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane has a molecular weight of 254.46 g/mol, XLogP of 5.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-methylcyclohexan-1-one;1,1,4-trimethylcyclohexane is sourced from PubChem (CID 160725349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).