C7H12O — CID 137332365
(4S)-3,3-dideuterio-4-methylcyclohexan-1-one (PubChem CID 137332365) has the molecular formula C7H12O and a molecular weight of 114.18 g/mol. Its IUPAC name is (4S)-3,3-dideuterio-4-methylcyclohexan-1-one.
| Compound Name | (4S)-3,3-dideuterio-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 137332365 |
| Molecular Formula | C7H12O |
| Molecular Weight | 114.18 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | (4S)-3,3-dideuterio-4-methylcyclohexan-1-one |
| SMILES | [2H]C1([2H])CC(=O)CC[C@@H]1C |
| InChI | InChI=1S/C7H12O/c1-6-2-4-7(8)5-3-6/h6H,2-5H2,1H3/i2D2/t6-/m1/s1 |
| InChIKey | VGVHNLRUAMRIEW-KNFMSPMWSA-N |
| XLogP | 1.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |