C13H24 — CID 142284308
(1Z)-1,2,3,3,6-pentamethylcyclooctene (PubChem CID 142284308) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (1Z)-1,2,3,3,6-pentamethylcyclooctene.
| Compound Name | (1Z)-1,2,3,3,6-pentamethylcyclooctene |
|---|---|
| PubChem CID | 142284308 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (1Z)-1,2,3,3,6-pentamethylcyclooctene |
| SMILES | C/C1=C(\C)C(C)(C)CCC(C)CC1 |
| InChI | InChI=1S/C13H24/c1-10-6-7-11(2)12(3)13(4,5)9-8-10/h10H,6-9H2,1-5H3/b12-11- |
| InChIKey | NNKUOLXNTZNPPU-QXMHVHEDSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|