About ethane;6-methylspiro[2.5]octane
ethane;6-methylspiro[2.5]octane (PubChem CID 142110397) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is ethane;6-methylspiro[2.5]octane.
Molecular Properties
| Compound Name | ethane;6-methylspiro[2.5]octane |
| PubChem CID | 142110397 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | ethane;6-methylspiro[2.5]octane |
| SMILES | CC.CC1CCC2(CC1)CC2 |
| InChI | InChI=1S/C9H16.C2H6/c1-8-2-4-9(5-3-8)6-7-9;1-2/h8H,2-7H2,1H3;1-2H3 |
| InChIKey | FCTMFIOBCBWTCM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;6-methylspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methylspiro[2.5]octane?
The IUPAC name of ethane;6-methylspiro[2.5]octane (CID 142110397) is ethane;6-methylspiro[2.5]octane.
What is the SMILES notation for ethane;6-methylspiro[2.5]octane?
The canonical SMILES for ethane;6-methylspiro[2.5]octane is CC.CC1CCC2(CC1)CC2.
What is the InChIKey of ethane;6-methylspiro[2.5]octane?
The InChIKey is FCTMFIOBCBWTCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.C2H6/c1-8-2-4-9(5-3-8)6-7-9;1-2/h8H,2-7H2,1H3;1-2H3.
What are the key properties of ethane;6-methylspiro[2.5]octane?
ethane;6-methylspiro[2.5]octane has a molecular weight of 154.30 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methylspiro[2.5]octane is sourced from PubChem (CID 142110397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).