About ethane;3-methylspiro[4.4]nonane
ethane;3-methylspiro[4.4]nonane (PubChem CID 168995417) has the molecular formula C14H30
and a molecular weight of 198.39 g/mol. Its IUPAC name is ethane;3-methylspiro[4.4]nonane.
Molecular Properties
| Compound Name | ethane;3-methylspiro[4.4]nonane |
| PubChem CID | 168995417 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | ethane;3-methylspiro[4.4]nonane |
| SMILES | CC.CC.CC1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C10H18.2C2H6/c1-9-4-7-10(8-9)5-2-3-6-10;2*1-2/h9H,2-8H2,1H3;2*1-2H3 |
| InChIKey | GNTHZMRAOXWLPN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;3-methylspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylspiro[4.4]nonane?
The IUPAC name of ethane;3-methylspiro[4.4]nonane (CID 168995417) is ethane;3-methylspiro[4.4]nonane.
What is the SMILES notation for ethane;3-methylspiro[4.4]nonane?
The canonical SMILES for ethane;3-methylspiro[4.4]nonane is CC.CC.CC1CCC2(CCCC2)C1.
What is the InChIKey of ethane;3-methylspiro[4.4]nonane?
The InChIKey is GNTHZMRAOXWLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.2C2H6/c1-9-4-7-10(8-9)5-2-3-6-10;2*1-2/h9H,2-8H2,1H3;2*1-2H3.
What are the key properties of ethane;3-methylspiro[4.4]nonane?
ethane;3-methylspiro[4.4]nonane has a molecular weight of 198.39 g/mol, XLogP of 5.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylspiro[4.4]nonane is sourced from PubChem (CID 168995417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).