C18H32S2 — CID 146581705
11-methyldispiro[4.2.68.35]heptadecane-13,16-dithiol (PubChem CID 146581705) has the molecular formula C18H32S2 and a molecular weight of 312.59 g/mol. Its IUPAC name is 11-methyldispiro[4.2.68.35]heptadecane-13,16-dithiol.
| Compound Name | 11-methyldispiro[4.2.68.35]heptadecane-13,16-dithiol |
|---|---|
| PubChem CID | 146581705 |
| Molecular Formula | C18H32S2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 11-methyldispiro[4.2.68.35]heptadecane-13,16-dithiol |
| SMILES | CC1CCC2(CCC3(CCCC3)CC(S)C2)CC(S)C1 |
| InChI | InChI=1S/C18H32S2/c1-14-4-7-18(11-15(19)10-14)9-8-17(5-2-3-6-17)12-16(20)13-18/h14-16,19-20H,2-13H2,1H3 |
| InChIKey | IPOVQRAEMGYTLJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|