About (2S,3S)-2,3-dimethylspiro[4.4]nonane
(2S,3S)-2,3-dimethylspiro[4.4]nonane (PubChem CID 58622704) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethylspiro[4.4]nonane.
Molecular Properties
| Compound Name | (2S,3S)-2,3-dimethylspiro[4.4]nonane |
| PubChem CID | 58622704 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (2S,3S)-2,3-dimethylspiro[4.4]nonane |
| SMILES | C[C@H]1CC2(CCCC2)C[C@@H]1C |
| InChI | InChI=1S/C11H20/c1-9-7-11(8-10(9)2)5-3-4-6-11/h9-10H,3-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | GYOUCMCTAHNQAF-UWVGGRQHSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2S,3S)-2,3-dimethylspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-dimethylspiro[4.4]nonane?
The IUPAC name of (2S,3S)-2,3-dimethylspiro[4.4]nonane (CID 58622704) is (2S,3S)-2,3-dimethylspiro[4.4]nonane.
What is the SMILES notation for (2S,3S)-2,3-dimethylspiro[4.4]nonane?
The canonical SMILES for (2S,3S)-2,3-dimethylspiro[4.4]nonane is C[C@H]1CC2(CCCC2)C[C@@H]1C.
What is the InChIKey of (2S,3S)-2,3-dimethylspiro[4.4]nonane?
The InChIKey is GYOUCMCTAHNQAF-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H20/c1-9-7-11(8-10(9)2)5-3-4-6-11/h9-10H,3-8H2,1-2H3/t9-,10-/m0/s1.
What are the key properties of (2S,3S)-2,3-dimethylspiro[4.4]nonane?
(2S,3S)-2,3-dimethylspiro[4.4]nonane has a molecular weight of 152.28 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-dimethylspiro[4.4]nonane is sourced from PubChem (CID 58622704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).