C14H24 — CID 123272406
spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,1'-cyclohexane] (PubChem CID 123272406) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,1'-cyclohexane].
| Compound Name | spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 123272406 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,1'-cyclohexane] |
| SMILES | C1CCC2(CC1)CC1CCCCC1C2 |
| InChI | InChI=1S/C14H24/c1-4-8-14(9-5-1)10-12-6-2-3-7-13(12)11-14/h12-13H,1-11H2 |
| InChIKey | BDZBFYDTQRZILZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |