C17H30 — CID 140778076
(3aR,6aS)-4'-tert-butylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,1'-cyclohexane] (PubChem CID 140778076) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is (3aR,6aS)-4'-tert-butylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,1'-cyclohexane].
| Compound Name | (3aR,6aS)-4'-tert-butylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,1'-cyclohexane] |
|---|---|
| PubChem CID | 140778076 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | (3aR,6aS)-4'-tert-butylspiro[2,3,3a,4,6,6a-hexahydro-1H-pentalene-5,1'-cyclohexane] |
| SMILES | CC(C)(C)C1CCC2(CC1)C[C@H]1CCC[C@H]1C2 |
| InChI | InChI=1S/C17H30/c1-16(2,3)15-7-9-17(10-8-15)11-13-5-4-6-14(13)12-17/h13-15H,4-12H2,1-3H3/t13-,14+,15?,17? |
| InChIKey | OCTYAYMQYIUQGV-KWOWKCNFSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |