C14H26ClN — CID 131865526
(4aS,8aS)-spiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,4'-piperidine];hydrochloride (PubChem CID 131865526) has the molecular formula C14H26ClN and a molecular weight of 243.82 g/mol. Its IUPAC name is (4aS,8aS)-spiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,4'-piperidine];hydrochloride.
| Compound Name | (4aS,8aS)-spiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,4'-piperidine];hydrochloride |
|---|---|
| PubChem CID | 131865526 |
| Molecular Formula | C14H26ClN |
| Molecular Weight | 243.82 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (4aS,8aS)-spiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,4'-piperidine];hydrochloride |
| SMILES | C1CC[C@H]2CC3(CCNCC3)CC[C@@H]2C1.Cl |
| InChI | InChI=1S/C14H25N.ClH/c1-2-4-13-11-14(6-5-12(13)3-1)7-9-15-10-8-14;/h12-13,15H,1-11H2;1H/t12-,13-;/m0./s1 |
| InChIKey | CAXUVPXRLKHSBW-QNTKWALQSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |