C16H24 — CID 123331321
pentacyclo[8.2.1.11,3.14,6.17,9]hexadecane (PubChem CID 123331321) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is pentacyclo[8.2.1.11,3.14,6.17,9]hexadecane.
| Compound Name | pentacyclo[8.2.1.11,3.14,6.17,9]hexadecane |
|---|---|
| PubChem CID | 123331321 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | pentacyclo[8.2.1.11,3.14,6.17,9]hexadecane |
| SMILES | C1CC23CC1C1CC(C1)C1CC(C1)C(C2)C3 |
| InChI | InChI=1S/C16H24/c1-2-16-7-10(1)11-3-12(4-11)13-5-14(6-13)15(8-16)9-16/h10-15H,1-9H2 |
| InChIKey | LOVBWTWGYBQZDO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |