C13H23N3 — CID 134443835
7-(2-azaspiro[3.4]octan-6-yl)-2,5-diazaspiro[3.4]octane (PubChem CID 134443835) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 7-(2-azaspiro[3.4]octan-6-yl)-2,5-diazaspiro[3.4]octane.
| Compound Name | 7-(2-azaspiro[3.4]octan-6-yl)-2,5-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 134443835 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 7-(2-azaspiro[3.4]octan-6-yl)-2,5-diazaspiro[3.4]octane |
| SMILES | C1CC2(CNC2)CC1C1CNC2(CNC2)C1 |
| InChI | InChI=1S/C13H23N3/c1-2-12(6-14-7-12)3-10(1)11-4-13(16-5-11)8-15-9-13/h10-11,14-16H,1-9H2 |
| InChIKey | BSMFFWBDZNOOBN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |