About 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane
1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane (PubChem CID 167199390) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane |
| PubChem CID | 167199390 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane |
| SMILES | C1CC2(CCN2C2CNC3(CNC3)C2)CN1 |
| InChI | InChI=1S/C12H22N4/c1-3-13-9-12(1)2-4-16(12)10-5-11(15-6-10)7-14-8-11/h10,13-15H,1-9H2 |
| InChIKey | UGBLEGWQAXPHCQ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane?
The IUPAC name of 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane (CID 167199390) is 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane.
What is the SMILES notation for 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane?
The canonical SMILES for 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane is C1CC2(CCN2C2CNC3(CNC3)C2)CN1.
What is the InChIKey of 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane?
The InChIKey is UGBLEGWQAXPHCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-3-13-9-12(1)2-4-16(12)10-5-11(15-6-10)7-14-8-11/h10,13-15H,1-9H2.
What are the key properties of 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane?
1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane has a molecular weight of 222.34 g/mol, XLogP of -0.87, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-diazaspiro[3.4]octan-7-yl)-1,7-diazaspiro[3.4]octane is sourced from PubChem (CID 167199390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).