C10H19N3 — CID 162741869
1-piperidin-4-yl-1,6-diazaspiro[3.3]heptane (PubChem CID 162741869) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-piperidin-4-yl-1,6-diazaspiro[3.3]heptane.
| Compound Name | 1-piperidin-4-yl-1,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 162741869 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-piperidin-4-yl-1,6-diazaspiro[3.3]heptane |
| SMILES | C1CC(N2CCC23CNC3)CCN1 |
| InChI | InChI=1S/C10H19N3/c1-4-11-5-2-9(1)13-6-3-10(13)7-12-8-10/h9,11-12H,1-8H2 |
| InChIKey | ZOBGNVJLVDTJLB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |