C14H30N4 — CID 70577124
1-cyclooctyl-1,4-diazocane-2,2-diamine (PubChem CID 70577124) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-cyclooctyl-1,4-diazocane-2,2-diamine.
| Compound Name | 1-cyclooctyl-1,4-diazocane-2,2-diamine |
|---|---|
| PubChem CID | 70577124 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 1-cyclooctyl-1,4-diazocane-2,2-diamine |
| SMILES | NC1(N)CNCCCCN1C1CCCCCCC1 |
| InChI | InChI=1S/C14H30N4/c15-14(16)12-17-10-6-7-11-18(14)13-8-4-2-1-3-5-9-13/h13,17H,1-12,15-16H2 |
| InChIKey | AZCMNKAZRFFWED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|