About 1-cyclooctyl-1,4-diazocane-2,2-diamine
1-cyclooctyl-1,4-diazocane-2,2-diamine (PubChem CID 70577124) has the molecular formula C14H30N4
and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-cyclooctyl-1,4-diazocane-2,2-diamine.
Molecular Properties
| Compound Name | 1-cyclooctyl-1,4-diazocane-2,2-diamine |
| PubChem CID | 70577124 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | 1-cyclooctyl-1,4-diazocane-2,2-diamine |
| SMILES | NC1(N)CNCCCCN1C1CCCCCCC1 |
| InChI | InChI=1S/C14H30N4/c15-14(16)12-17-10-6-7-11-18(14)13-8-4-2-1-3-5-9-13/h13,17H,1-12,15-16H2 |
| InChIKey | AZCMNKAZRFFWED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclooctyl-1,4-diazocane-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclooctyl-1,4-diazocane-2,2-diamine?
The IUPAC name of 1-cyclooctyl-1,4-diazocane-2,2-diamine (CID 70577124) is 1-cyclooctyl-1,4-diazocane-2,2-diamine.
What is the SMILES notation for 1-cyclooctyl-1,4-diazocane-2,2-diamine?
The canonical SMILES for 1-cyclooctyl-1,4-diazocane-2,2-diamine is NC1(N)CNCCCCN1C1CCCCCCC1.
What is the InChIKey of 1-cyclooctyl-1,4-diazocane-2,2-diamine?
The InChIKey is AZCMNKAZRFFWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N4/c15-14(16)12-17-10-6-7-11-18(14)13-8-4-2-1-3-5-9-13/h13,17H,1-12,15-16H2.
What are the key properties of 1-cyclooctyl-1,4-diazocane-2,2-diamine?
1-cyclooctyl-1,4-diazocane-2,2-diamine has a molecular weight of 254.42 g/mol, XLogP of 1.36, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclooctyl-1,4-diazocane-2,2-diamine is sourced from PubChem (CID 70577124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).