C14H26N2O — CID 97372335
(6S)-4-cyclohexyl-1-oxa-4,8-diazaspiro[5.5]undecane (PubChem CID 97372335) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (6S)-4-cyclohexyl-1-oxa-4,8-diazaspiro[5.5]undecane.
| Compound Name | (6S)-4-cyclohexyl-1-oxa-4,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 97372335 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (6S)-4-cyclohexyl-1-oxa-4,8-diazaspiro[5.5]undecane |
| SMILES | C1CCC(N2CCO[C@]3(CCCNC3)C2)CC1 |
| InChI | InChI=1S/C14H26N2O/c1-2-5-13(6-3-1)16-9-10-17-14(12-16)7-4-8-15-11-14/h13,15H,1-12H2/t14-/m0/s1 |
| InChIKey | JLDMPYWQDGDBRT-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |