About 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride
3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride (PubChem CID 156735226) has the molecular formula C12H26Cl2N2
and a molecular weight of 269.26 g/mol. Its IUPAC name is 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride |
| PubChem CID | 156735226 |
| Molecular Formula | C12H26Cl2N2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride |
| SMILES | CC1(C)CCCN(C2CCNCC2)C1.Cl.Cl |
| InChI | InChI=1S/C12H24N2.2ClH/c1-12(2)6-3-9-14(10-12)11-4-7-13-8-5-11;;/h11,13H,3-10H2,1-2H3;2*1H |
| InChIKey | BLDGVQKEDRQJIL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride?
The IUPAC name of 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride (CID 156735226) is 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride.
What is the SMILES notation for 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride?
The canonical SMILES for 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride is CC1(C)CCCN(C2CCNCC2)C1.Cl.Cl.
What is the InChIKey of 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride?
The InChIKey is BLDGVQKEDRQJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.2ClH/c1-12(2)6-3-9-14(10-12)11-4-7-13-8-5-11;;/h11,13H,3-10H2,1-2H3;2*1H.
What are the key properties of 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride?
3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride has a molecular weight of 269.26 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-piperidin-4-ylpiperidine;dihydrochloride is sourced from PubChem (CID 156735226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).