C11H22N2 — CID 80561996
3-(3,3-dimethylpiperidin-1-yl)cyclobutan-1-amine (PubChem CID 80561996) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 3-(3,3-dimethylpiperidin-1-yl)cyclobutan-1-amine.
| Compound Name | 3-(3,3-dimethylpiperidin-1-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 80561996 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 3-(3,3-dimethylpiperidin-1-yl)cyclobutan-1-amine |
| SMILES | CC1(C)CCCN(C2CC(N)C2)C1 |
| InChI | InChI=1S/C11H22N2/c1-11(2)4-3-5-13(8-11)10-6-9(12)7-10/h9-10H,3-8,12H2,1-2H3 |
| InChIKey | KJJIHJBFESVCCY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |