C15H28N2O — CID 64845611
6-(3-methoxycyclohexyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64845611) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 6-(3-methoxycyclohexyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 6-(3-methoxycyclohexyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64845611 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 6-(3-methoxycyclohexyl)-6,9-diazaspiro[4.5]decane |
| SMILES | COC1CCCC(N2CCNCC23CCCC3)C1 |
| InChI | InChI=1S/C15H28N2O/c1-18-14-6-4-5-13(11-14)17-10-9-16-12-15(17)7-2-3-8-15/h13-14,16H,2-12H2,1H3 |
| InChIKey | YVOJSNPMMQJMEZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |