About (4R)-1,7-diazaspiro[3.4]octane
(4R)-1,7-diazaspiro[3.4]octane (PubChem CID 97135320) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is (4R)-1,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | (4R)-1,7-diazaspiro[3.4]octane |
| PubChem CID | 97135320 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (4R)-1,7-diazaspiro[3.4]octane |
| SMILES | C1C[C@]2(CCN2)CN1 |
| InChI | InChI=1S/C6H12N2/c1-3-7-5-6(1)2-4-8-6/h7-8H,1-5H2/t6-/m0/s1 |
| InChIKey | JAUHHUMGLNVJQI-LURJTMIESA-N |
| XLogP | -0.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-1,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,7-diazaspiro[3.4]octane?
The IUPAC name of (4R)-1,7-diazaspiro[3.4]octane (CID 97135320) is (4R)-1,7-diazaspiro[3.4]octane.
What is the SMILES notation for (4R)-1,7-diazaspiro[3.4]octane?
The canonical SMILES for (4R)-1,7-diazaspiro[3.4]octane is C1C[C@]2(CCN2)CN1.
What is the InChIKey of (4R)-1,7-diazaspiro[3.4]octane?
The InChIKey is JAUHHUMGLNVJQI-LURJTMIESA-N. The full InChI is InChI=1S/C6H12N2/c1-3-7-5-6(1)2-4-8-6/h7-8H,1-5H2/t6-/m0/s1.
What are the key properties of (4R)-1,7-diazaspiro[3.4]octane?
(4R)-1,7-diazaspiro[3.4]octane has a molecular weight of 112.18 g/mol, XLogP of -0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,7-diazaspiro[3.4]octane is sourced from PubChem (CID 97135320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).