About 1,8-diazaspiro[3.5]nonane;propane
1,8-diazaspiro[3.5]nonane;propane (PubChem CID 123647748) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 1,8-diazaspiro[3.5]nonane;propane.
Molecular Properties
| Compound Name | 1,8-diazaspiro[3.5]nonane;propane |
| PubChem CID | 123647748 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1,8-diazaspiro[3.5]nonane;propane |
| SMILES | C1CNCC2(C1)CCN2.CCC |
| InChI | InChI=1S/C7H14N2.C3H8/c1-2-7(3-5-9-7)6-8-4-1;1-3-2/h8-9H,1-6H2;3H2,1-2H3 |
| InChIKey | VMWBJQSLGARCQV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8-diazaspiro[3.5]nonane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-diazaspiro[3.5]nonane;propane?
The IUPAC name of 1,8-diazaspiro[3.5]nonane;propane (CID 123647748) is 1,8-diazaspiro[3.5]nonane;propane.
What is the SMILES notation for 1,8-diazaspiro[3.5]nonane;propane?
The canonical SMILES for 1,8-diazaspiro[3.5]nonane;propane is C1CNCC2(C1)CCN2.CCC.
What is the InChIKey of 1,8-diazaspiro[3.5]nonane;propane?
The InChIKey is VMWBJQSLGARCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C3H8/c1-2-7(3-5-9-7)6-8-4-1;1-3-2/h8-9H,1-6H2;3H2,1-2H3.
What are the key properties of 1,8-diazaspiro[3.5]nonane;propane?
1,8-diazaspiro[3.5]nonane;propane has a molecular weight of 170.30 g/mol, XLogP of 1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-diazaspiro[3.5]nonane;propane is sourced from PubChem (CID 123647748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).