About 8-deuterio-1,8-diazaspiro[3.5]nonane
8-deuterio-1,8-diazaspiro[3.5]nonane (PubChem CID 175836066) has the molecular formula C7H14N2
and a molecular weight of 127.21 g/mol. Its IUPAC name is 8-deuterio-1,8-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 8-deuterio-1,8-diazaspiro[3.5]nonane |
| PubChem CID | 175836066 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.12 |
| IUPAC Name | 8-deuterio-1,8-diazaspiro[3.5]nonane |
| SMILES | [2H]N1CCCC2(CCN2)C1 |
| InChI | InChI=1S/C7H14N2/c1-2-7(3-5-9-7)6-8-4-1/h8-9H,1-6H2/i/hD |
| InChIKey | NGWVMUHZQFHIFX-DYCDLGHISA-N |
| XLogP | 0.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-deuterio-1,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-deuterio-1,8-diazaspiro[3.5]nonane?
The IUPAC name of 8-deuterio-1,8-diazaspiro[3.5]nonane (CID 175836066) is 8-deuterio-1,8-diazaspiro[3.5]nonane.
What is the SMILES notation for 8-deuterio-1,8-diazaspiro[3.5]nonane?
The canonical SMILES for 8-deuterio-1,8-diazaspiro[3.5]nonane is [2H]N1CCCC2(CCN2)C1.
What is the InChIKey of 8-deuterio-1,8-diazaspiro[3.5]nonane?
The InChIKey is NGWVMUHZQFHIFX-DYCDLGHISA-N. The full InChI is InChI=1S/C7H14N2/c1-2-7(3-5-9-7)6-8-4-1/h8-9H,1-6H2/i/hD.
What are the key properties of 8-deuterio-1,8-diazaspiro[3.5]nonane?
8-deuterio-1,8-diazaspiro[3.5]nonane has a molecular weight of 127.21 g/mol, XLogP of 0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-deuterio-1,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 175836066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).