About 1-azaspiro[4.5]decane
1-azaspiro[4.5]decane (PubChem CID 9092) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 1-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 1-azaspiro[4.5]decane |
| PubChem CID | 9092 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 1-azaspiro[4.5]decane |
| SMILES | C1CCC2(CC1)CCCN2 |
| InChI | InChI=1S/C9H17N/c1-2-5-9(6-3-1)7-4-8-10-9/h10H,1-8H2 |
| InChIKey | LGKNCSVHCNCJQG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[4.5]decane?
The IUPAC name of 1-azaspiro[4.5]decane (CID 9092) is 1-azaspiro[4.5]decane.
What is the SMILES notation for 1-azaspiro[4.5]decane?
The canonical SMILES for 1-azaspiro[4.5]decane is C1CCC2(CC1)CCCN2.
What is the InChIKey of 1-azaspiro[4.5]decane?
The InChIKey is LGKNCSVHCNCJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-2-5-9(6-3-1)7-4-8-10-9/h10H,1-8H2.
What are the key properties of 1-azaspiro[4.5]decane?
1-azaspiro[4.5]decane has a molecular weight of 139.24 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[4.5]decane is sourced from PubChem (CID 9092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).